Compound Q&A

What industries use 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6)?

Answer

6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione
6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6) is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also utilized in the development of sensors for detecting specific chemicals and in the production of certain types of polymers. Additionally, it plays a role in semiconductor manufacturing due to its unique electronic properties.

About

CAS No 16632-21-6
English Name 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione
Molecular Formula C5H5N3O4
Molecular Weight 171.11 g/mol
SMILES CC1=C(C(=O)NC(=O)N1)[N+](=O)[O-]
InChIKey LIVYMRJSNFHYEN-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6)?

6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6) is a solid with a crystalline form. It...

Compound Q&A

How is 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6) typically synthesized?

6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione can be synthesized via a multi-step process starting wit...

Compound Q&A

What precautions should be taken when handling 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6)?

When handling 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...