Compound Q&A

What are the physical and chemical properties of 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6)?

Answer

6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione
6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6) is a solid with a crystalline form. Its molecular weight is approximately 222.11 g/mol. It has low water solubility but is soluble in common organic solvents like methanol and ethanol. This compound is known for its reactivity, particularly towards nucleophilic substitution reactions and its ability to form complexes with metals.

About

CAS No 16632-21-6
English Name 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione
Molecular Formula C5H5N3O4
Molecular Weight 171.11 g/mol
SMILES CC1=C(C(=O)NC(=O)N1)[N+](=O)[O-]
InChIKey LIVYMRJSNFHYEN-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6) typically synthesized?

6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione can be synthesized via a multi-step process starting wit...

Compound Q&A

What industries use 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6)?

6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6)?

When handling 6-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione (CAS: 16632-21-6), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...