Compound Q&A

How is 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1) typically synthesized?

Answer

3-Methyl-1-octyl-1H-imidazol-3-ium chloride
3-Methyl-1-octyl-1H-imidazol-3-ium chloride is synthesized through the reaction of 3-methyl-1-octylimidazole with hydrochloric acid. The process involves heating the imidazole to promote the protonation, followed by cooling and crystallization. Yields are generally high, and the product is obtained as a white crystalline solid.

About

CAS No 64697-40-1
English Name 3-Methyl-1-octyl-1H-imidazol-3-ium chloride
Molecular Formula C12H23ClN2
Molecular Weight 230.78 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.[Cl-]
InChIKey OXFBEEDAZHXDHB-UHFFFAOYSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1)?

3-Methyl-1-octyl-1H-imidazol-3-ium chloride is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1)?

3-Methyl-1-octyl-1H-imidazol-3-ium chloride is primarily used in the pharmaceutical industry for its...

Compound Q&A

What precautions should be taken when handling 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1)?

When handling 3-Methyl-1-octyl-1H-imidazol-3-ium chloride, it is recommended to wear personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...