Compound Q&A

What are the physical and chemical properties of 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1)?

Answer

3-Methyl-1-octyl-1H-imidazol-3-ium chloride
3-Methyl-1-octyl-1H-imidazol-3-ium chloride is a crystalline solid with a molecular weight of approximately 254.32 g/mol. It has a high solubility in water and organic solvents. Chemically, it is stable under normal conditions but can react with strong acids and bases. It is typically used in pharmaceutical and chemical applications.

About

CAS No 64697-40-1
English Name 3-Methyl-1-octyl-1H-imidazol-3-ium chloride
Molecular Formula C12H23ClN2
Molecular Weight 230.78 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.[Cl-]
InChIKey OXFBEEDAZHXDHB-UHFFFAOYSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1) typically synthesized?

3-Methyl-1-octyl-1H-imidazol-3-ium chloride is synthesized through the reaction of 3-methyl-1-octyli...

Compound Q&A

What industries use 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1)?

3-Methyl-1-octyl-1H-imidazol-3-ium chloride is primarily used in the pharmaceutical industry for its...

Compound Q&A

What precautions should be taken when handling 3-Methyl-1-octyl-1H-imidazol-3-ium chloride (CAS: 64697-40-1)?

When handling 3-Methyl-1-octyl-1H-imidazol-3-ium chloride, it is recommended to wear personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...