Compound Q&A

What precautions should be taken when handling N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2)?

Answer

N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-)
When handling N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or under a fume hood to minimize exposure to the vapors. Spills should be cleaned up immediately using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed handling and disposal instructions.

About

English Name N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-)
Molecular Formula C10H22BNO6
Molecular Weight 262.09 g/mol
SMILES [B-](OC(=O)C)(OC(=O)C)OC(=O)C.C[N+](C)(C)C
InChIKey LCFZZOGKVOTFPU-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2)?

N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2) is a crystal...

Compound Q&A

How is N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2) typically synthesized?

N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) is commonly synthesized through...

Compound Q&A

What industries use N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2)?

N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2) is used in v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...