Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2)?

Answer

N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-)
N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2) is a crystalline compound with a molecular weight of approximately 330.33 g/mol. It is soluble in organic solvents like acetone and methanol but has limited solubility in water. The compound exhibits basic properties due to the ammonium cation. It reacts readily with acidic substances and is stable under normal conditions but should be handled with care to avoid reactions with strong acids or bases.

About

English Name N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-)
Molecular Formula C10H22BNO6
Molecular Weight 262.09 g/mol
SMILES [B-](OC(=O)C)(OC(=O)C)OC(=O)C.C[N+](C)(C)C
InChIKey LCFZZOGKVOTFPU-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2) typically synthesized?

N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) is commonly synthesized through...

Compound Q&A

What industries use N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2)?

N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2) is used in v...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2)?

When handling N,N,N-Trimethylmethanaminium tris(acetato-kappaO)(hydrido)borate(1-) (CAS: 109704-53-2...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...