Compound Q&A

What precautions should be taken when handling {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid (CAS: 64506-49-6)?

Answer

{5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid
Handling this compound requires appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dark place away from heat and ignition sources. In case of spills, the area should be ventilated and the spill cleaned up using appropriate absorbents. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 64506-49-6
English Name {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid
Molecular Formula C27H30O6
Molecular Weight 450.53 g/mol
SMILES CC(=CCOC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)OCC=C(C)C)OCC(=O)O)C
InChIKey GFWRVVCDTLRWPK-KPKJPENVSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid (CAS: 64506-49-6) typically synthesized?

The compound is synthesized via a multi-step process involving the synthesis of key intermediates su...

Compound Q&A

What industries use {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid (CAS: 64506-49-6)?

The compound is primarily used in pharmaceuticals and chemical research due to its complex structure...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...