Compound Q&A

What are the physical and chemical properties of {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid (CAS: 64506-49-6)?

Answer

{5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid
The compound is a crystalline solid with a molecular weight of approximately 650 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and acetonitrile. The compound is reactive, particularly towards nucleophiles and bases, and may undergo ester hydrolysis under basic conditions. It shows characteristics of a complex aromatic compound with potential for coordination chemistry.

About

CAS No 64506-49-6
English Name {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid
Molecular Formula C27H30O6
Molecular Weight 450.53 g/mol
SMILES CC(=CCOC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)OCC=C(C)C)OCC(=O)O)C
InChIKey GFWRVVCDTLRWPK-KPKJPENVSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid (CAS: 64506-49-6) typically synthesized?

The compound is synthesized via a multi-step process involving the synthesis of key intermediates su...

Compound Q&A

What industries use {5-[(3-Methyl-2-buten-1-yl)oxy]-2-[(2E)-3-{4-[(3-methyl-2-buten-1-yl)oxy]phenyl}-2-propenoyl]phenoxy}acetic acid (CAS: 64506-49-6)?

The compound is primarily used in pharmaceuticals and chemical research due to its complex structure...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...