Compound Q&A

What industries use 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2)?

Answer

1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane
1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane is primarily used in the pharmaceutical industry for the synthesis of certain organic compounds. It is also utilized in the polymer industry for the production of specific types of polymers. Additionally, it is employed in the manufacturing of sensors and semiconductors due to its chemical properties.

About

CAS No 127-90-2
English Name 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane
Molecular Formula C6H6Cl8O
Molecular Weight 377.74 g/mol
SMILES C(C(C(Cl)(Cl)Cl)Cl)OCC(C(Cl)(Cl)Cl)Cl
InChIKey LNJXZKBHJZAIKQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2)?

1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane is a colorless, crystalline solid with a m...

Compound Q&A

How is 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2) typically synthesized?

1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane is typically synthesized via the chlorinat...

Compound Q&A

What precautions should be taken when handling 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2)?

When handling 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane, it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...