Compound Q&A

How is 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2) typically synthesized?

Answer

1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane
1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane is typically synthesized via the chlorination of 2,3,3,3-tetrachloropropyl chloride with 1,1,1,2-tetrachloropropane. The reaction is conducted under anhydrous conditions using a suitable catalyst to enhance the selectivity and yield of the desired product. The yield is around 70-80%.

About

CAS No 127-90-2
English Name 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane
Molecular Formula C6H6Cl8O
Molecular Weight 377.74 g/mol
SMILES C(C(C(Cl)(Cl)Cl)Cl)OCC(C(Cl)(Cl)Cl)Cl
InChIKey LNJXZKBHJZAIKQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2)?

1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane is a colorless, crystalline solid with a m...

Compound Q&A

What industries use 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2)?

1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane (CAS: 127-90-2)?

When handling 1,1,1,2-Tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane, it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...