Compound Q&A

How is 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5) typically synthesized?

Answer

3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate
3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate is typically synthesized through a multistep process involving the coupling of a phenylcarbamate derivative with a 3-(ethoxycarbonylamino) phenylamine. Common solvents include dichloromethane, and the reaction is catalyzed by a suitable base such as triethylamine. The yield is generally high, around 85-90%, and the method involves protecting groups and careful temperature control.

About

CAS No 13684-56-5
English Name 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate
Molecular Formula C16H16N2O4
Molecular Weight 300.31 g/mol
SMILES CCOC(=O)Nc1cccc(c1)OC(=O)Nc2ccccc2
InChIKey WZJZMXBKUWKXTQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5)?

3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate is a solid with a crystalline form. Its molecular we...

Compound Q&A

What industries use 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5)?

3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate is used in pharmaceuticals for intermediate synthesi...

Compound Q&A

What precautions should be taken when handling 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5)?

Handling 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate requires appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...