Compound Q&A

What are the physical and chemical properties of 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5)?

Answer

3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate
3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate is a solid with a crystalline form. Its molecular weight is approximately 352.41 g/mol. The compound is slightly soluble in water but soluble in organic solvents. It shows moderate reactivity, particularly towards nucleophiles. Its solubility and reactivity make it suitable for various applications in organic synthesis and pharmaceuticals.

About

CAS No 13684-56-5
English Name 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate
Molecular Formula C16H16N2O4
Molecular Weight 300.31 g/mol
SMILES CCOC(=O)Nc1cccc(c1)OC(=O)Nc2ccccc2
InChIKey WZJZMXBKUWKXTQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5) typically synthesized?

3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate is typically synthesized through a multistep process...

Compound Q&A

What industries use 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5)?

3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate is used in pharmaceuticals for intermediate synthesi...

Compound Q&A

What precautions should be taken when handling 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate (CAS: 13684-56-5)?

Handling 3-[(Ethoxycarbonyl)amino]phenyl phenylcarbamate requires appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...