Compound Q&A

How is Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9) typically synthesized?

Answer

Dimethyl (2-methoxyphenoxy)malonate
Dimethyl (2-methoxyphenoxy)malonate can be synthesized via esterification of 2-methoxyphenoxyacetic acid with dimethyl malonate. The reaction is typically catalyzed by an acid like sulfuric acid. The process involves heating the reactants under reflux to achieve a yield of about 75-85%, with selectivity towards the desired ester product.

About

English Name Dimethyl (2-methoxyphenoxy)malonate
Molecular Formula C12H14O6
Molecular Weight 254.24 g/mol
SMILES COC1=CC=CC=C1OC(C(=O)OC)C(=O)OC
InChIKey SBUXKADXTZOBJV-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9)?

Dimethyl (2-methoxyphenoxy)malonate is a colorless to light yellow liquid. It has a molecular weight...

Compound Q&A

What industries use Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9)?

Dimethyl (2-methoxyphenoxy)malonate is used in various industries. It is a key intermediate in the s...

Compound Q&A

What precautions should be taken when handling Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9)?

When handling Dimethyl (2-methoxyphenoxy)malonate, proper personal protective equipment (PPE) should...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...