Compound Q&A

What are the physical and chemical properties of Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9)?

Answer

Dimethyl (2-methoxyphenoxy)malonate
Dimethyl (2-methoxyphenoxy)malonate is a colorless to light yellow liquid. It has a molecular weight of approximately 198.22 g/mol and a density of 1.09 g/cm³. The compound is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. It is moderately reactive and can undergo ester hydrolysis, making it susceptible to base-catalyzed breakdown.

About

English Name Dimethyl (2-methoxyphenoxy)malonate
Molecular Formula C12H14O6
Molecular Weight 254.24 g/mol
SMILES COC1=CC=CC=C1OC(C(=O)OC)C(=O)OC
InChIKey SBUXKADXTZOBJV-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9) typically synthesized?

Dimethyl (2-methoxyphenoxy)malonate can be synthesized via esterification of 2-methoxyphenoxyacetic ...

Compound Q&A

What industries use Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9)?

Dimethyl (2-methoxyphenoxy)malonate is used in various industries. It is a key intermediate in the s...

Compound Q&A

What precautions should be taken when handling Dimethyl (2-methoxyphenoxy)malonate (CAS: 150726-89-9)?

When handling Dimethyl (2-methoxyphenoxy)malonate, proper personal protective equipment (PPE) should...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...