Compound Q&A

How is Rociletinib (CAS: 1374640-70-6) typically synthesized?

Answer

Rociletinib
Rociletinib is typically synthesized through multi-step organic synthesis involving key reactions such as alkylation, nucleophilic substitution, and condensation. The synthesis often requires the use of reagents like chlorides and amines, with the use of catalysts to improve selectivity and yield. The process involves careful control of reaction conditions to ensure product purity and yield.

About

English Name Rociletinib
Molecular Formula C27H28F3N7O3
Molecular Weight 555.56 g/mol
SMILES CC(=O)N1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC(=CC=C4)NC(=O)C=C)C(F)(F)F)OC
InChIKey HUFOZJXAKZVRNJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rociletinib (CAS: 1374640-70-6)?

Rociletinib is a crystalline compound with a molecular weight of approximately 453.45 g/mol. It has ...

Compound Q&A

What industries use Rociletinib (CAS: 1374640-70-6)?

Rociletinib is primarily used in the pharmaceutical industry for its role as an inhibitor of the Tro...

Compound Q&A

What precautions should be taken when handling Rociletinib (CAS: 1374640-70-6)?

When handling Rociletinib, it is crucial to wear appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...