Compound Q&A

What are the physical and chemical properties of Rociletinib (CAS: 1374640-70-6)?

Answer

Rociletinib
Rociletinib is a crystalline compound with a molecular weight of approximately 453.45 g/mol. It has a limited solubility in water, but is more soluble in organic solvents like methanol and DMSO. Rociletinib is known for its chemical stability under normal storage conditions, although it should be stored away from heat and direct sunlight. It reacts selectively with certain functional groups and is generally considered to have moderate reactivity under typical synthetic conditions.

About

English Name Rociletinib
Molecular Formula C27H28F3N7O3
Molecular Weight 555.56 g/mol
SMILES CC(=O)N1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC(=CC=C4)NC(=O)C=C)C(F)(F)F)OC
InChIKey HUFOZJXAKZVRNJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Rociletinib (CAS: 1374640-70-6) typically synthesized?

Rociletinib is typically synthesized through multi-step organic synthesis involving key reactions su...

Compound Q&A

What industries use Rociletinib (CAS: 1374640-70-6)?

Rociletinib is primarily used in the pharmaceutical industry for its role as an inhibitor of the Tro...

Compound Q&A

What precautions should be taken when handling Rociletinib (CAS: 1374640-70-6)?

When handling Rociletinib, it is crucial to wear appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...