Compound Q&A

How is Phenyl phosphate disodium salt (CAS: 3279-54-7) typically synthesized?

Answer

Phenyl phosphate disodium salt
Phenyl phosphate disodium salt is typically synthesized by reacting phenyl phosphate with sodium hydroxide in a suitable solvent. The reaction is carried out under basic conditions and yields high purity product with good selectivity. The process involves careful temperature control to ensure the desired product formation and high yield.

About

CAS No 3279-54-7
English Name Phenyl phosphate disodium salt
Molecular Formula C6H5Na2O4P
Molecular Weight 218.05 g/mol
SMILES C1=CC=C(C=C1)OP(=O)([O-])[O-].[Na+].[Na+]
InChIKey TYJOJLOWRIQYQM-UHFFFAOYSA-L
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phenyl phosphate disodium salt (CAS: 3279-54-7)?

Phenyl phosphate disodium salt (CAS: 3279-54-7) has a crystalline form and a molecular weight of app...

Compound Q&A

What industries use Phenyl phosphate disodium salt (CAS: 3279-54-7)?

Phenyl phosphate disodium salt (CAS: 3279-54-7) is used in various industries, particularly in pharm...

Compound Q&A

What precautions should be taken when handling Phenyl phosphate disodium salt (CAS: 3279-54-7)?

When handling Phenyl phosphate disodium salt (CAS: 3279-54-7), it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...