Compound Q&A

What are the physical and chemical properties of Phenyl phosphate disodium salt (CAS: 3279-54-7)?

Answer

Phenyl phosphate disodium salt
Phenyl phosphate disodium salt (CAS: 3279-54-7) has a crystalline form and a molecular weight of approximately 299.29 g/mol. It is sparingly soluble in water and has good solubility in common organic solvents. The compound is relatively stable but can react with strong bases or acids. It has a melting point of about 214-217°C and decomposes above this temperature.

About

CAS No 3279-54-7
English Name Phenyl phosphate disodium salt
Molecular Formula C6H5Na2O4P
Molecular Weight 218.05 g/mol
SMILES C1=CC=C(C=C1)OP(=O)([O-])[O-].[Na+].[Na+]
InChIKey TYJOJLOWRIQYQM-UHFFFAOYSA-L
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Phenyl phosphate disodium salt (CAS: 3279-54-7) typically synthesized?

Phenyl phosphate disodium salt is typically synthesized by reacting phenyl phosphate with sodium hyd...

Compound Q&A

What industries use Phenyl phosphate disodium salt (CAS: 3279-54-7)?

Phenyl phosphate disodium salt (CAS: 3279-54-7) is used in various industries, particularly in pharm...

Compound Q&A

What precautions should be taken when handling Phenyl phosphate disodium salt (CAS: 3279-54-7)?

When handling Phenyl phosphate disodium salt (CAS: 3279-54-7), it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...