Compound Q&A

What are the physical and chemical properties of Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8)?

Answer

Ethyl 1-benzyl-4-piperidinecarboxylate
Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8) is a crystalline solid with a molecular weight of approximately 250.33 g/mol. It is slightly soluble in water and miscible in organic solvents like ethanol and acetonitrile. This compound is known for its low reactivity under normal conditions, but it can react with bases to form salts. It has a pKa of around 3.5, indicating it is a weak acid.

About

CAS No 24228-40-8
English Name Ethyl 1-benzyl-4-piperidinecarboxylate
Molecular Formula C15H21NO2
Molecular Weight 247.34 g/mol
SMILES CCOC(=O)C1CCN(CC1)CC2=CC=CC=C2
InChIKey ASQCOPJFYLJCGD-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8) typically synthesized?

Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8) is typically synthesized through the reacti...

Compound Q&A

What industries use Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8)?

Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8) is used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8)?

Proper handling of Ethyl 1-benzyl-4-piperidinecarboxylate (CAS: 24228-40-8) requires personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...