Compound Q&A

What precautions should be taken when handling N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8)?

Answer

N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
When handling this compound, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated environment or a fume hood to avoid inhalation of potential vapors. In case of spillage, immediately clean up using appropriate absorbent materials and dispose of them in accordance with local regulations. Always refer to the safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

English Name N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
Molecular Formula C81H68N4O8
Molecular Weight 1225.43 g/mol
SMILES COC1=CC=C(N(C2=CC=C(OC)C=C2)C3=CC4=C(C=C3)C5=C(C64C7=C(C8=C6C=C(N(C9=CC=C(OC)C=C9)C%10=CC=C(OC)C=C%10)C=C8)C=CC(N(C%11=CC=C(OC)C=C%11)C%12=CC=C(OC)C=C%12)=C7)C=C(N(C%13=CC=C(OC)C=C%13)C%14=CC=C(OC)C=C%14)C=C5)C=C1
InChIKey XDXWNHPWWKGTKO-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8)?

This compound is a crystalline material with a high molecular weight, approximately 2168.4 g/mol. It...

Compound Q&A

How is N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8) typically synthesized?

The compound is synthesized through the condensation reaction of 4-methoxyphenyl isocyanates with 9,...

Compound Q&A

What industries use N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8)?

This compound is primarily used in the pharmaceutical, polymer, and semiconductor industries. In pha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...