Compound Q&A

What are the physical and chemical properties of N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8)?

Answer

N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
This compound is a crystalline material with a high molecular weight, approximately 2168.4 g/mol. It has low solubility in water but is more soluble in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). Chemically, it exhibits good stability but can react with reducing agents under certain conditions. It is often used in the synthesis of functionalized polymers and semiconductors.

About

English Name N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
Molecular Formula C81H68N4O8
Molecular Weight 1225.43 g/mol
SMILES COC1=CC=C(N(C2=CC=C(OC)C=C2)C3=CC4=C(C=C3)C5=C(C64C7=C(C8=C6C=C(N(C9=CC=C(OC)C=C9)C%10=CC=C(OC)C=C%10)C=C8)C=CC(N(C%11=CC=C(OC)C=C%11)C%12=CC=C(OC)C=C%12)=C7)C=C(N(C%13=CC=C(OC)C=C%13)C%14=CC=C(OC)C=C%14)C=C5)C=C1
InChIKey XDXWNHPWWKGTKO-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8) typically synthesized?

The compound is synthesized through the condensation reaction of 4-methoxyphenyl isocyanates with 9,...

Compound Q&A

What industries use N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8)?

This compound is primarily used in the pharmaceutical, polymer, and semiconductor industries. In pha...

Compound Q&A

What precautions should be taken when handling N,N,N',N',N'',N'',N''',N'''-Octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS: 207739-72-8)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...