Compound Q&A

What industries use (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6)?

Answer

(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid
(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid finds applications in pharmaceuticals, particularly as a raw material for drug intermediates. It is also used in the formulation of cosmetics and in the production of certain natural products. Additionally, it has potential applications in the food industry as a preservative and in agricultural chemicals.

About

CAS No 631-69-6
English Name (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid
Molecular Formula C30H48O3
Molecular Weight 456.71 g/mol
SMILES C[C@]1(C(O)=O)[C@H](O)CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])[C@@H](C)[C@H](C)CC[C@@](C)5CC[C@](C)4[C@@](C)3CCC12
InChIKey NBGQZFQREPIKMG-QYKAKFGWSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6)?

(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid is a solid at room temperature, with a molecular weight ...

Compound Q&A

How is (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6) typically synthesized?

(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid is often synthesized through the hydrolysis of ursolic a...

Compound Q&A

What precautions should be taken when handling (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6)?

When handling (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6), appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...