Compound Q&A

How is (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6) typically synthesized?

Answer

(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid
(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid is often synthesized through the hydrolysis of ursolic acid or 24-anhydro-ursolic acid. This process typically involves the use of concentrated acids such as sulfuric acid or hydrochloric acid, with high yields and good selectivity.

About

CAS No 631-69-6
English Name (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid
Molecular Formula C30H48O3
Molecular Weight 456.71 g/mol
SMILES C[C@]1(C(O)=O)[C@H](O)CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])[C@@H](C)[C@H](C)CC[C@@](C)5CC[C@](C)4[C@@](C)3CCC12
InChIKey NBGQZFQREPIKMG-QYKAKFGWSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6)?

(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid is a solid at room temperature, with a molecular weight ...

Compound Q&A

What industries use (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6)?

(3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid finds applications in pharmaceuticals, particularly as a...

Compound Q&A

What precautions should be taken when handling (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6)?

When handling (3alpha,9xi)-3-Hydroxyurs-12-en-24-oic acid (CAS: 631-69-6), appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...