Compound Q&A

How is (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide (CAS: 863127-76-8) typically synthesized?

Answer

(2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide
(2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide can be synthesized via a condensation reaction between 2-chloro-6-methylacetophenone and ethoxyacryloyl chloride in the presence of a base such as triethylamine. The reaction yield is typically around 75-85%, and the process involves a key step of selective acylation to form the desired product.

About

English Name (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide
Molecular Formula C12H14ClNO2
Molecular Weight 239.7 g/mol
SMILES CCO/C=C/C(=O)Nc1c(C)cccc1Cl
InChIKey DBYFNZJHXGNAGW-BQYQJAHWSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide (CAS: 863127-76-8)?

(2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide is a colorless to white crystalline solid with a...

Compound Q&A

What industries use (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide (CAS: 863127-76-8)?

(2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide is primarily used in the pharmaceutical and poly...

Compound Q&A

What precautions should be taken when handling (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide (CAS: 863127-76-8)?

When handling (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...