Compound Q&A

How is (-)-Blebbistatin (CAS: 856925-71-8) typically synthesized?

Answer

(-)-Blebbistatin
(-)-Blebbistatin is typically synthesized via a multi-step process involving organic transformations such as alkylation, hydrolysis, and oxidation. The key steps involve the preparation of an intermediate compound from blebbistatin, followed by enantioselective synthesis using chiral catalysts to achieve high yield and selectivity.

About

English Name (-)-Blebbistatin
Molecular Formula C18H16N2O2
Molecular Weight 292.33 g/mol
SMILES CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O
InChIKey LZAXPYOBKSJSEX-GOSISDBHSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (-)-Blebbistatin (CAS: 856925-71-8)?

(-)-Blebbistatin is a crystalline compound with a molecular weight of approximately 441.34 g/mol. It...

Compound Q&A

What industries use (-)-Blebbistatin (CAS: 856925-71-8)?

(-)-Blebbistatin is primarily used in the pharmaceutical and research industries for its role in inh...

Compound Q&A

What precautions should be taken when handling (-)-Blebbistatin (CAS: 856925-71-8)?

When handling (-)-Blebbistatin, it is important to use personal protective equipment such as gloves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...