Compound Q&A

What are the physical and chemical properties of (-)-Blebbistatin (CAS: 856925-71-8)?

Answer

(-)-Blebbistatin
(-)-Blebbistatin is a crystalline compound with a molecular weight of approximately 441.34 g/mol. It has a solubility of about 0.25 mg/mL in DMSO. Chemically, it is relatively stable but can be sensitive to acidic conditions. It has been used in biological assays due to its specific inhibition of myosin II ATPase activity.

About

English Name (-)-Blebbistatin
Molecular Formula C18H16N2O2
Molecular Weight 292.33 g/mol
SMILES CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O
InChIKey LZAXPYOBKSJSEX-GOSISDBHSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is (-)-Blebbistatin (CAS: 856925-71-8) typically synthesized?

(-)-Blebbistatin is typically synthesized via a multi-step process involving organic transformations...

Compound Q&A

What industries use (-)-Blebbistatin (CAS: 856925-71-8)?

(-)-Blebbistatin is primarily used in the pharmaceutical and research industries for its role in inh...

Compound Q&A

What precautions should be taken when handling (-)-Blebbistatin (CAS: 856925-71-8)?

When handling (-)-Blebbistatin, it is important to use personal protective equipment such as gloves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...