Compound Q&A

How is Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6) typically synthesized?

Answer

Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate
This compound can be synthesized via a Wittig reaction, where a phosphonium salt reacts with an aldehyde and methoxy group-containing compound. The reaction typically requires a Lewis acid catalyst like aluminium trichloride. The method yields a predominantly cis-isomer due to the steric hindrance provided by the methyl groups.

About

CAS No 65733-16-6
English Name Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate
Molecular Formula C19H34O3
Molecular Weight 310.48 g/mol
SMILES COC(CCC[C@@H](C/C=C/C(=CC(=O)OC(C)C)C)C)(C)C
InChIKey NFGXHKASABOEEW-GYMWBFJFSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6)?

Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate has a crystalline form, with a m...

Compound Q&A

What industries use Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6)?

This compound is used in the pharmaceutical industry for developing certain drug formulations, and i...

Compound Q&A

What precautions should be taken when handling Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6)?

When handling this compound, use proper personal protective equipment (PPE) including gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...