Compound Q&A

What are the physical and chemical properties of Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6)?

Answer

Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate
Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate has a crystalline form, with a molecular weight of approximately 344.5 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is reactive, particularly towards nucleophilic substitution and addition reactions. Its reactivity can be influenced by its methoxy group, trimethyl groups, and double bonds.

About

CAS No 65733-16-6
English Name Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate
Molecular Formula C19H34O3
Molecular Weight 310.48 g/mol
SMILES COC(CCC[C@@H](C/C=C/C(=CC(=O)OC(C)C)C)C)(C)C
InChIKey NFGXHKASABOEEW-GYMWBFJFSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6) typically synthesized?

This compound can be synthesized via a Wittig reaction, where a phosphonium salt reacts with an alde...

Compound Q&A

What industries use Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6)?

This compound is used in the pharmaceutical industry for developing certain drug formulations, and i...

Compound Q&A

What precautions should be taken when handling Isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 65733-16-6)?

When handling this compound, use proper personal protective equipment (PPE) including gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...