Compound Q&A

How is 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) typically synthesized?

Answer

1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane
1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) is synthesized through the reaction of hexafluorocyclohexane with bromine in the presence of a Lewis acid catalyst, such as aluminum bromide. The reaction is typically carried out under an inert atmosphere to prevent decomposition. The yield is high, and the product is isolated by recrystallization from an appropriate solvent, ensuring purity and high-quality final product.

About

CAS No 335-56-8
English Name 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane
Molecular Formula C6BrF13
Molecular Weight 398.94 g/mol
SMILES C(C(C(C(F)(F)Br)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F
InChIKey JTYRBFORUCBNHJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8)?

1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) is a colorless, crystalline so...

Compound Q&A

What industries use 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8)?

1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8)?

When handling 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8), it is important...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...