Compound Q&A

What are the physical and chemical properties of 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8)?

Answer

1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane
1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) is a colorless, crystalline solid. It has a molecular weight of approximately 429.7 g/mol and is virtually insoluble in water but soluble in organic solvents like dichloromethane and toluene. It exhibits low reactivity, making it suitable for various synthetic applications without significant decomposition. It is characterized by high stability and low vapor pressure, ensuring safe handling and storage under standard laboratory conditions.

About

CAS No 335-56-8
English Name 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane
Molecular Formula C6BrF13
Molecular Weight 398.94 g/mol
SMILES C(C(C(C(F)(F)Br)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F
InChIKey JTYRBFORUCBNHJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) typically synthesized?

1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) is synthesized through the rea...

Compound Q&A

What industries use 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8)?

1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8) is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8)?

When handling 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS: 335-56-8), it is important...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...