Compound Q&A

How is 3-Iodotyrosine (CAS: 70-78-0) typically synthesized?

Answer

3-Iodotyrosine
3-Iodotyrosine is typically synthesized by the iodination of tyrosine. This process involves treating tyrosine with iodine in the presence of a base like sodium hydroxide. The reaction is often performed in an aqueous medium, and the selectivity for the iodination can be controlled by adjusting the reaction conditions. The yield and purity of the product can be improved using appropriate purification techniques.

About

CAS No 70-78-0
English Name 3-Iodotyrosine
Molecular Formula C9H10INO3
Molecular Weight 307.09 g/mol
SMILES C1=CC(=C(C=C1CC(C(=O)O)N)I)O
InChIKey UQTZMGFTRHFAAM-ZETCQYMHSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodotyrosine (CAS: 70-78-0)?

3-Iodotyrosine (CAS: 70-78-0) is a crystalline solid with a molecular weight of approximately 243.79...

Compound Q&A

What industries use 3-Iodotyrosine (CAS: 70-78-0)?

3-Iodotyrosine (CAS: 70-78-0) finds applications in the pharmaceutical industry due to its structura...

Compound Q&A

What precautions should be taken when handling 3-Iodotyrosine (CAS: 70-78-0)?

When handling 3-Iodotyrosine (CAS: 70-78-0), it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...