Compound Q&A

What industries use 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9)?

Answer

3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride
3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) is primarily used in pharmaceuticals for its fluorescence properties, which are beneficial in drug discovery and development. It is also used in polymer science for its dyeing properties, in sensor technology for detection of specific analytes, and in semiconductor applications for its light-emitting characteristics. Its fluorescence makes it suitable for use in various analytical and diagnostic techniques.

About

CAS No 62669-70-9
English Name 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride
Molecular Formula C21H17ClN2O3
Molecular Weight 380.82 g/mol
SMILES [Cl-].COC(=O)c1ccccc1c2c3ccc(N)cc3[o+]c4cc(N)ccc24
InChIKey TUFFYSFVSYUHPA-UHFFFAOYSA-M
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9)?

The compound 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) is a cry...

Compound Q&A

How is 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) typically synthesized?

3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) is typically synthesi...

Compound Q&A

What precautions should be taken when handling 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9)?

When handling 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...