Compound Q&A

How is 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) typically synthesized?

Answer

3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride
3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) is typically synthesized via the coupling of 3,6-diaminobenzanthrone with 2-(methoxycarbonyl)benzaldehyde. The reaction involves protecting the amine groups, coupling them with the aldehyde, and then chlorinating the resulting product to form the xanthenium chloride. Common catalysts include palladium(II) acetate and triphenylphosphine. The yield is generally around 70%, and the reaction is performed under mild conditions to ensure selectivity.

About

CAS No 62669-70-9
English Name 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride
Molecular Formula C21H17ClN2O3
Molecular Weight 380.82 g/mol
SMILES [Cl-].COC(=O)c1ccccc1c2c3ccc(N)cc3[o+]c4cc(N)ccc24
InChIKey TUFFYSFVSYUHPA-UHFFFAOYSA-M
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9)?

The compound 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) is a cry...

Compound Q&A

What industries use 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9)?

3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9) is primarily used in ...

Compound Q&A

What precautions should be taken when handling 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9)?

When handling 3,6-Diamino-9-[2-(methoxycarbonyl)phenyl]xanthenium chloride (CAS: 62669-70-9), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...