Compound Q&A

What precautions should be taken when handling 5-Methylisophthalic acid (CAS: 499-49-0)?

Answer

5-Methylisophthalic acid
When handling 5-Methylisophthalic acid (CAS: 499-49-0), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and lab coat. Handle in a fume hood to avoid inhalation. Spills should be handled carefully, and the area should be thoroughly cleaned. Refer to the safety data sheet (SDS) for detailed handling and disposal information.

About

CAS No 499-49-0
English Name 5-Methylisophthalic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES CC1=CC(=CC(=C1)C(=O)O)C(=O)O
InChIKey PMZBHPUNQNKBOA-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methylisophthalic acid (CAS: 499-49-0)?

5-Methylisophthalic acid (CAS: 499-49-0) is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is 5-Methylisophthalic acid (CAS: 499-49-0) typically synthesized?

5-Methylisophthalic acid is typically synthesized by the oxidation of 4-methylanisole using a suitab...

Compound Q&A

What industries use 5-Methylisophthalic acid (CAS: 499-49-0)?

5-Methylisophthalic acid (CAS: 499-49-0) is primarily used in the pharmaceutical and polymer industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...