Compound Q&A

What are the physical and chemical properties of 5-Methylisophthalic acid (CAS: 499-49-0)?

Answer

5-Methylisophthalic acid
5-Methylisophthalic acid (CAS: 499-49-0) is a white crystalline solid with a molecular weight of approximately 166.13 g/mol. It is slightly soluble in water, with a solubility of about 0.5 g/L at 25°C. This compound exhibits moderate reactivity, particularly in esterification reactions. It is used in the synthesis of polymers and pharmaceuticals.

About

CAS No 499-49-0
English Name 5-Methylisophthalic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES CC1=CC(=CC(=C1)C(=O)O)C(=O)O
InChIKey PMZBHPUNQNKBOA-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 5-Methylisophthalic acid (CAS: 499-49-0) typically synthesized?

5-Methylisophthalic acid is typically synthesized by the oxidation of 4-methylanisole using a suitab...

Compound Q&A

What industries use 5-Methylisophthalic acid (CAS: 499-49-0)?

5-Methylisophthalic acid (CAS: 499-49-0) is primarily used in the pharmaceutical and polymer industr...

Compound Q&A

What precautions should be taken when handling 5-Methylisophthalic acid (CAS: 499-49-0)?

When handling 5-Methylisophthalic acid (CAS: 499-49-0), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...