Compound Q&A

How is 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1) typically synthesized?

Answer

2-Chloro-1,4-benzenediamine sulfate (1:1)
2-Chloro-1,4-benzenediamine sulfate (1:1) is typically synthesized by the reaction of 2-chloro-1,4-benzenediamine with sulfuric acid. The reaction involves the protonation of the amine groups, followed by the formation of the sulfate salt. The yield is generally high, and the reaction is conducted under mild conditions to avoid degradation of the product.

About

CAS No 61702-44-1
English Name 2-Chloro-1,4-benzenediamine sulfate (1:1)
Molecular Formula C6H9ClN2O4S
Molecular Weight 240.67 g/mol
SMILES Nc1ccc(N)c(Cl)c1.OS(=O)(=O)O
InChIKey GQFGHCRXPLROOF-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1)?

2-Chloro-1,4-benzenediamine sulfate (1:1) is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1)?

2-Chloro-1,4-benzenediamine sulfate (1:1) is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1)?

When handling 2-Chloro-1,4-benzenediamine sulfate (1:1), appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...