Compound Q&A

What are the physical and chemical properties of 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1)?

Answer

2-Chloro-1,4-benzenediamine sulfate (1:1)
2-Chloro-1,4-benzenediamine sulfate (1:1) is a white crystalline solid with a molecular weight of approximately 252.84 g/mol. It has a low solubility in water (0.22 g/100 mL at 20°C) and is reactive towards acids. It shows basic properties due to the amine groups and can react with acids to form salts.

About

CAS No 61702-44-1
English Name 2-Chloro-1,4-benzenediamine sulfate (1:1)
Molecular Formula C6H9ClN2O4S
Molecular Weight 240.67 g/mol
SMILES Nc1ccc(N)c(Cl)c1.OS(=O)(=O)O
InChIKey GQFGHCRXPLROOF-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1) typically synthesized?

2-Chloro-1,4-benzenediamine sulfate (1:1) is typically synthesized by the reaction of 2-chloro-1,4-b...

Compound Q&A

What industries use 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1)?

2-Chloro-1,4-benzenediamine sulfate (1:1) is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1,4-benzenediamine sulfate (1:1) (CAS: 61702-44-1)?

When handling 2-Chloro-1,4-benzenediamine sulfate (1:1), appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...