Compound Q&A

Are there alternatives to ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CAS: 206184-49-8) in synthesis?

Answer

({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (1:1)
There are alternative reagents and compounds that can be used in syntheses as substitutes for ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CAS: 206184-49-8), such as related phosphonic acids or analogs with similar functional groups. The choice depends on the specific requirements of the synthesis and the desired properties of the final product.

About

English Name ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (1:1)
Molecular Formula C9H16N5O5P
Molecular Weight 305.23 g/mol
SMILES C[C@H](Cn1cnc2c1ncnc2N)OCP(=O)(O)O.O
InChIKey PINIEAOMWQJGBW-FYZOBXCZSA-N
Last Updated: 2025-09-21 10:38

Related Q&A

Compound Q&A

What regulatory guidelines apply to ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CAS: 206184-49-8)?

({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CAS: 206184-49-8) i...

Compound Q&A

What is the market or research trend for ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CAS: 206184-49-8)?

The market for ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CAS:...

Compound Q&A

How should waste containing ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CAS: 206184-49-8) be handled?

Waste containing ({[(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid hydrate (CA...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...