Compound Q&A

Are there alternatives to 2,3-Dinonylnaphthalene-1-sulfonic acid (CAS: 25322-17-2) in synthesis?

Answer

2,3-Dinonylnaphthalene-1-sulfonic acid
There are alternative sulfonic acids and naphthene compounds that can be used in synthesis, such as 1-naphthoic acid and other sulfonating agents like benzenesulfonyl chloride. These alternatives offer similar reactivity but may have different physical and chemical properties, thus requiring adjustments in the synthesis conditions.

About

CAS No 25322-17-2
English Name 2,3-Dinonylnaphthalene-1-sulfonic acid
Molecular Formula C28H44O3S
Molecular Weight 460.71 g/mol
EINECS 246-841-9
SMILES CCCCCCCCCc1cc2ccccc2c(c1CCCCCCCCC)S(=O)(=O)O
InChIKey WDNQRCVBPNOTNV-UHFFFAOYSA-N
Last Updated: 2025-09-20 20:46

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,3-Dinonylnaphthalene-1-sulfonic acid (CAS: 25322-17-2)?

2,3-Dinonylnaphthalene-1-sulfonic acid (CAS: 25322-17-2) falls under the scope of various regulatory...

Compound Q&A

What is the market or research trend for 2,3-Dinonylnaphthalene-1-sulfonic acid (CAS: 25322-17-2)?

The market trend for 2,3-Dinonylnaphthalene-1-sulfonic acid (CAS: 25322-17-2) reflects increasing de...

Compound Q&A

How should waste containing 2,3-Dinonylnaphthalene-1-sulfonic acid (CAS: 25322-17-2) be handled?

Waste containing 2,3-Dinonylnaphthalene-1-sulfonic acid (CAS: 25322-17-2) should be collected in app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...