Compound Q&A

What industries use Biotinyl-GHK tripeptide (CAS: 299157-54-3)?

Answer

Biotinyl-GHK tripeptide
Biotinyl-GHK tripeptide is widely used in the pharmaceutical industry for skin care products due to its ability to stimulate collagen synthesis. It is also utilized in the cosmetic industry for anti-aging formulations. Additionally, it finds applications in bioconjugation for biosensors and as a component in peptide-based drug delivery systems.

About

English Name Biotinyl-GHK tripeptide
Molecular Formula C24H38N8O6S
Molecular Weight 566.67 g/mol
SMILES NCCCC[C@@H](C(=O)O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)CCCC[C@H]1SC[C@@H]2[C@H]1NC(=O)N2
InChIKey WCKVVODUWGBPQV-JDNULILRSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Biotinyl-GHK tripeptide (CAS: 299157-54-3)?

Biotinyl-GHK tripeptide is a crystalline compound with a molecular weight of approximately 498.44 g/...

Compound Q&A

How is Biotinyl-GHK tripeptide (CAS: 299157-54-3) typically synthesized?

Biotinyl-GHK tripeptide is typically synthesized through solid-phase peptide synthesis (SPPS) using ...

Compound Q&A

What precautions should be taken when handling Biotinyl-GHK tripeptide (CAS: 299157-54-3)?

When handling Biotinyl-GHK tripeptide, it is essential to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...