Compound Q&A

How is Biotinyl-GHK tripeptide (CAS: 299157-54-3) typically synthesized?

Answer

Biotinyl-GHK tripeptide
Biotinyl-GHK tripeptide is typically synthesized through solid-phase peptide synthesis (SPPS) using standard Fmoc chemistry. The tripeptide is assembled on a solid support, with the biotin group introduced at the final step. Commonly, the biotinylation reaction involves the use of N-hydroxysuccinimide (NHS) ester biotin, which reacts selectively with the free amine group of the tripeptide to form an amide bond.

About

English Name Biotinyl-GHK tripeptide
Molecular Formula C24H38N8O6S
Molecular Weight 566.67 g/mol
SMILES NCCCC[C@@H](C(=O)O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)CCCC[C@H]1SC[C@@H]2[C@H]1NC(=O)N2
InChIKey WCKVVODUWGBPQV-JDNULILRSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Biotinyl-GHK tripeptide (CAS: 299157-54-3)?

Biotinyl-GHK tripeptide is a crystalline compound with a molecular weight of approximately 498.44 g/...

Compound Q&A

What industries use Biotinyl-GHK tripeptide (CAS: 299157-54-3)?

Biotinyl-GHK tripeptide is widely used in the pharmaceutical industry for skin care products due to ...

Compound Q&A

What precautions should be taken when handling Biotinyl-GHK tripeptide (CAS: 299157-54-3)?

When handling Biotinyl-GHK tripeptide, it is essential to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...