Compound Q&A

How is 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) typically synthesized?

Answer

2,2,3,3-Tetrafluoropropyl methacrylate
2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) is typically synthesized via the reaction of tetrafluoropropene with methacryloyl chloride in the presence of a base. The process involves careful control of temperature and reaction time to achieve high yield and selectivity. Common catalysts and bases used include triethylamine and dimethylformamide.

About

CAS No 45102-52-1
English Name 2,2,3,3-Tetrafluoropropyl methacrylate
Molecular Formula C7H8F4O2
Molecular Weight 200.13 g/mol
SMILES CC(=C)C(=O)OCC(C(F)F)(F)F
InChIKey RSVZYSKAPMBSMY-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1)?

2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) is a colorless liquid with a high molecular...

Compound Q&A

What industries use 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1)?

2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) is widely used in the pharmaceutical, polym...

Compound Q&A

What precautions should be taken when handling 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1)?

When handling 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...