Compound Q&A

What are the physical and chemical properties of 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1)?

Answer

2,2,3,3-Tetrafluoropropyl methacrylate
2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) is a colorless liquid with a high molecular weight of approximately 222.02 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. Chemically, it is highly reactive, particularly towards nucleophiles, and is used in polymer chemistry due to its fluorine content, which enhances fluoropolymer properties.

About

CAS No 45102-52-1
English Name 2,2,3,3-Tetrafluoropropyl methacrylate
Molecular Formula C7H8F4O2
Molecular Weight 200.13 g/mol
SMILES CC(=C)C(=O)OCC(C(F)F)(F)F
InChIKey RSVZYSKAPMBSMY-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) typically synthesized?

2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) is typically synthesized via the reaction o...

Compound Q&A

What industries use 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1)?

2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1) is widely used in the pharmaceutical, polym...

Compound Q&A

What precautions should be taken when handling 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1)?

When handling 2,2,3,3-Tetrafluoropropyl methacrylate (CAS: 45102-52-1), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...