Compound Q&A

What are the physical and chemical properties of (2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid (CAS: 79561-82-3)?

Answer

(2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid
(2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid is a white crystalline solid with a molecular weight of approximately 341.27 g/mol. It is slightly soluble in water but soluble in organic solvents like DMSO and methanol. It exhibits moderate reactivity, particularly with nucleophiles. This compound is stable under normal conditions but should be stored in a cool, dry place to prevent degradation.

About

CAS No 79561-82-3
English Name (2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid
Molecular Formula C14H18BrNO4
Molecular Weight 344.21 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)Br)C(=O)O
InChIKey ULNOXUAEIPUJMK-LLVKDONJSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is (2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid (CAS: 79561-82-3) typically synthesized?

(2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid is usually synthesized via the...

Compound Q&A

What industries use (2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid (CAS: 79561-82-3)?

(2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling (2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid (CAS: 79561-82-3)?

Proper handling of (2R)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid (CAS: 79561...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...