Compound Q&A

What precautions should be taken when handling 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6)?

Answer

4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (1:1)
When handling 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Perform reactions in a well-ventilated area or fume hood to minimize inhalation risk. Spills should be cleaned up using a suitable absorbent material, and the area should be washed down with water. Always refer to the safety data sheet (SDS) for detailed handling instructions.

About

CAS No 10039-26-6
English Name 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (1:1)
Molecular Formula C12H24O12
Molecular Weight 360.31 g/mol
SMILES C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O
InChIKey WSVLPVUVIUVCRA-RJMJUYIDSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6)?

4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) is a crystalline compound with...

Compound Q&A

How is 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) typically synthesized?

4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) is typically synthesized throu...

Compound Q&A

What industries use 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6)?

4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) finds application in the pharm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...