Compound Q&A

What are the physical and chemical properties of 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6)?

Answer

4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (1:1)
4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) is a crystalline compound with a molecular weight of approximately 464.5 g/mol. It has a high solubility in water and alcohols. Chemically, it is mildly reactive, particularly under acidic or basic conditions. It is stable under normal laboratory conditions but can be sensitive to moisture and air exposure.

About

CAS No 10039-26-6
English Name 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (1:1)
Molecular Formula C12H24O12
Molecular Weight 360.31 g/mol
SMILES C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O
InChIKey WSVLPVUVIUVCRA-RJMJUYIDSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) typically synthesized?

4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) is typically synthesized throu...

Compound Q&A

What industries use 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6)?

4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6) finds application in the pharm...

Compound Q&A

What precautions should be taken when handling 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6)?

When handling 4-O-beta-D-Galactopyranosyl-D-glucopyranose hydrate (CAS: 10039-26-6), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...