Compound Q&A

What industries use Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6)?

Answer

Palladium(2+) bis(trifluoroacetate)
Palladium(2+) bis(trifluoroacetate) finds applications in various industries. It is widely used in pharmaceuticals for the synthesis of complex organic molecules, in polymer chemistry for catalyzing cross-linking reactions, and in the production of sensors and semiconductors. Its use in homogeneous catalysis also makes it valuable in the chemical industry.

About

CAS No 42196-31-6
English Name Palladium(2+) bis(trifluoroacetate)
Molecular Formula C4F6O4Pd
Molecular Weight 332.45 g/mol
SMILES C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Pd+2]
InChIKey PBDBXAQKXCXZCJ-UHFFFAOYSA-L
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6)?

Palladium(2+) bis(trifluoroacetate) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6) typically synthesized?

Palladium(2+) bis(trifluoroacetate) is typically synthesized via the reaction of palladium(II) aceta...

Compound Q&A

What precautions should be taken when handling Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6)?

When handling Palladium(2+) bis(trifluoroacetate), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...