Compound Q&A

How is Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6) typically synthesized?

Answer

Palladium(2+) bis(trifluoroacetate)
Palladium(2+) bis(trifluoroacetate) is typically synthesized via the reaction of palladium(II) acetate with trifluoroacetic acid. The reaction involves the coordination of palladium(II) with two trifluoroacetate ligands. This method provides high selectivity and yield, making it a preferred route for producing this compound for catalytic applications.

About

CAS No 42196-31-6
English Name Palladium(2+) bis(trifluoroacetate)
Molecular Formula C4F6O4Pd
Molecular Weight 332.45 g/mol
SMILES C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Pd+2]
InChIKey PBDBXAQKXCXZCJ-UHFFFAOYSA-L
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6)?

Palladium(2+) bis(trifluoroacetate) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6)?

Palladium(2+) bis(trifluoroacetate) finds applications in various industries. It is widely used in p...

Compound Q&A

What precautions should be taken when handling Palladium(2+) bis(trifluoroacetate) (CAS: 42196-31-6)?

When handling Palladium(2+) bis(trifluoroacetate), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...