Compound Q&A

What precautions should be taken when handling Bedaquiline Impurity 6 (CAS: 654655-69-3)?

Answer

Bedaquiline Impurity 6
When handling Bedaquiline Impurity 6, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area, preferably in a fume hood. Spills should be cleaned up immediately using appropriate absorbents, and the material safety data sheet (MSDS) should be referenced for detailed safety instructions.

About

English Name Bedaquiline Impurity 6
Molecular Formula C17H14BrNO
Molecular Weight 328.21 g/mol
SMILES COC1=C(C=C2C=C(C=CC2=N1)Br)CC3=CC=CC=C3
InChIKey WMFHVNYOCKTDMX-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bedaquiline Impurity 6 (CAS: 654655-69-3)?

Bedaquiline Impurity 6 is a crystalline compound with a molecular weight of approximately 477.4 g/mo...

Compound Q&A

How is Bedaquiline Impurity 6 (CAS: 654655-69-3) typically synthesized?

Bedaquiline Impurity 6 is synthesized through a series of organic reactions, including Friedel-Craft...

Compound Q&A

What industries use Bedaquiline Impurity 6 (CAS: 654655-69-3)?

Bedaquiline Impurity 6 is primarily used in the pharmaceutical industry, particularly in the quality...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...