Compound Q&A

What are the physical and chemical properties of Bedaquiline Impurity 6 (CAS: 654655-69-3)?

Answer

Bedaquiline Impurity 6
Bedaquiline Impurity 6 is a crystalline compound with a molecular weight of approximately 477.4 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. The compound is relatively stable under normal conditions but can react with strong oxidants.

About

English Name Bedaquiline Impurity 6
Molecular Formula C17H14BrNO
Molecular Weight 328.21 g/mol
SMILES COC1=C(C=C2C=C(C=CC2=N1)Br)CC3=CC=CC=C3
InChIKey WMFHVNYOCKTDMX-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is Bedaquiline Impurity 6 (CAS: 654655-69-3) typically synthesized?

Bedaquiline Impurity 6 is synthesized through a series of organic reactions, including Friedel-Craft...

Compound Q&A

What industries use Bedaquiline Impurity 6 (CAS: 654655-69-3)?

Bedaquiline Impurity 6 is primarily used in the pharmaceutical industry, particularly in the quality...

Compound Q&A

What precautions should be taken when handling Bedaquiline Impurity 6 (CAS: 654655-69-3)?

When handling Bedaquiline Impurity 6, it is essential to use personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...